C28H36N8O6 — CID 91003040
N-[[5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-N'-(1-hydroxy-2H-isoindol-4-yl)decanediamide (PubChem CID 91003040) has the molecular formula C28H36N8O6 and a molecular weight of 580.65 g/mol. Its IUPAC name is N-[[5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-N'-(1-hydroxy-2H-isoindol-4-yl)decanediamide.
| Compound Name | N-[[5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-N'-(1-hydroxy-2H-isoindol-4-yl)decanediamide |
|---|---|
| PubChem CID | 91003040 |
| Molecular Formula | C28H36N8O6 |
| Molecular Weight | 580.65 g/mol |
| Exact Mass | 580.28 |
| IUPAC Name | N-[[5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-N'-(1-hydroxy-2H-isoindol-4-yl)decanediamide |
| SMILES | Nc1ncnc2c1ncn2C1OC(CNC(=O)CCCCCCCCC(=O)Nc2cccc3c(O)[nH]cc23)C(O)C1O |
| InChI | InChI=1S/C28H36N8O6/c29-25-22-26(33-14-32-25)36(15-34-22)28-24(40)23(39)19(42-28)13-30-20(37)10-5-3-1-2-4-6-11-21(38)35-18-9-7-8-16-17(18)12-31-27(16)41/h7-9,12,14-15,19,23-24,28,31,39-41H,1-6,10-11,13H2,(H,30,37)(H,35,38)(H2,29,32,33) |
| InChIKey | MMBVQQTULHYLNS-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 213.53 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.65 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|