C24H28N8O6 — CID 91573459
N-[[5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-N'-(1-hydroxy-2H-isoindol-4-yl)hexanediamide (PubChem CID 91573459) has the molecular formula C24H28N8O6 and a molecular weight of 524.54 g/mol. Its IUPAC name is N-[[5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-N'-(1-hydroxy-2H-isoindol-4-yl)hexanediamide.
| Compound Name | N-[[5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-N'-(1-hydroxy-2H-isoindol-4-yl)hexanediamide |
|---|---|
| PubChem CID | 91573459 |
| Molecular Formula | C24H28N8O6 |
| Molecular Weight | 524.54 g/mol |
| Exact Mass | 524.21 |
| IUPAC Name | N-[[5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-N'-(1-hydroxy-2H-isoindol-4-yl)hexanediamide |
| SMILES | Nc1ncnc2c1ncn2C1OC(CNC(=O)CCCCC(=O)Nc2cccc3c(O)[nH]cc23)C(O)C1O |
| InChI | InChI=1S/C24H28N8O6/c25-21-18-22(29-10-28-21)32(11-30-18)24-20(36)19(35)15(38-24)9-26-16(33)6-1-2-7-17(34)31-14-5-3-4-12-13(14)8-27-23(12)37/h3-5,8,10-11,15,19-20,24,27,35-37H,1-2,6-7,9H2,(H,26,33)(H,31,34)(H2,25,28,29) |
| InChIKey | WDFYGTJFHJCZLL-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 213.53 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.54 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|