C17H18N8O7 — CID 3581881
2-[6-amino-8-[2-[3-(5-nitrofuran-2-yl)prop-2-enylidene]hydrazinyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 3581881) has the molecular formula C17H18N8O7 and a molecular weight of 446.38 g/mol. Its IUPAC name is 2-[6-amino-8-[2-[3-(5-nitrofuran-2-yl)prop-2-enylidene]hydrazinyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | 2-[6-amino-8-[2-[3-(5-nitrofuran-2-yl)prop-2-enylidene]hydrazinyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 3581881 |
| Molecular Formula | C17H18N8O7 |
| Molecular Weight | 446.38 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | 2-[6-amino-8-[2-[3-(5-nitrofuran-2-yl)prop-2-enylidene]hydrazinyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | Nc1ncnc2c1nc(NN=CC=Cc1ccc([N+](=O)[O-])o1)n2C1OC(CO)C(O)C1O |
| InChI | InChI=1S/C17H18N8O7/c18-14-11-15(20-7-19-14)24(16-13(28)12(27)9(6-26)32-16)17(22-11)23-21-5-1-2-8-3-4-10(31-8)25(29)30/h1-5,7,9,12-13,16,26-28H,6H2,(H,22,23)(H2,18,19,20) |
| InChIKey | KZCDBEQVQKPOKI-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 220.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.38 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|