C14H15N3O2 — CID 166633207
(3Z)-3-[[4-(dimethylamino)phenyl]methylidene]-6-methylidenepiperazine-2,5-dione (PubChem CID 166633207) has the molecular formula C14H15N3O2 and a molecular weight of 257.29 g/mol. Its IUPAC name is (3Z)-3-[[4-(dimethylamino)phenyl]methylidene]-6-methylidenepiperazine-2,5-dione.
| Compound Name | (3Z)-3-[[4-(dimethylamino)phenyl]methylidene]-6-methylidenepiperazine-2,5-dione |
|---|---|
| PubChem CID | 166633207 |
| Molecular Formula | C14H15N3O2 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | (3Z)-3-[[4-(dimethylamino)phenyl]methylidene]-6-methylidenepiperazine-2,5-dione |
| SMILES | C=c1[nH]c(=O)/c(=C/c2ccc(N(C)C)cc2)[nH]c1=O |
| InChI | InChI=1S/C14H15N3O2/c1-9-13(18)16-12(14(19)15-9)8-10-4-6-11(7-5-10)17(2)3/h4-8H,1H2,2-3H3,(H,15,19)(H,16,18)/b12-8- |
| InChIKey | BNIRJNXVKBPDOW-WQLSENKSSA-N |
| XLogP | -0.63 |
| TPSA | 68.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|