C19H17IN2O2 — CID 1016696
4-[[4-(dimethylamino)phenyl]methylidene]-2-(3-iodo-4-methylphenyl)-1,3-oxazol-5-one (PubChem CID 1016696) has the molecular formula C19H17IN2O2 and a molecular weight of 432.26 g/mol. Its IUPAC name is 4-[[4-(dimethylamino)phenyl]methylidene]-2-(3-iodo-4-methylphenyl)-1,3-oxazol-5-one.
| Compound Name | 4-[[4-(dimethylamino)phenyl]methylidene]-2-(3-iodo-4-methylphenyl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 1016696 |
| Molecular Formula | C19H17IN2O2 |
| Molecular Weight | 432.26 g/mol |
| Exact Mass | 432.03 |
| IUPAC Name | 4-[[4-(dimethylamino)phenyl]methylidene]-2-(3-iodo-4-methylphenyl)-1,3-oxazol-5-one |
| SMILES | Cc1ccc(C2=NC(=Cc3ccc(N(C)C)cc3)C(=O)O2)cc1I |
| InChI | InChI=1S/C19H17IN2O2/c1-12-4-7-14(11-16(12)20)18-21-17(19(23)24-18)10-13-5-8-15(9-6-13)22(2)3/h4-11H,1-3H3 |
| InChIKey | KLMWEVZGIKFYFH-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.26 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|