C9H14N2O5S2 — CID 7730636
4-methoxy-3-[methyl(methylsulfonyl)amino]benzenesulfonamide (PubChem CID 7730636) has the molecular formula C9H14N2O5S2 and a molecular weight of 294.35 g/mol. Its IUPAC name is 4-methoxy-3-[methyl(methylsulfonyl)amino]benzenesulfonamide.
| Compound Name | 4-methoxy-3-[methyl(methylsulfonyl)amino]benzenesulfonamide |
|---|---|
| PubChem CID | 7730636 |
| Molecular Formula | C9H14N2O5S2 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.03 |
| IUPAC Name | 4-methoxy-3-[methyl(methylsulfonyl)amino]benzenesulfonamide |
| SMILES | COc1ccc(S(N)(=O)=O)cc1N(C)S(C)(=O)=O |
| InChI | InChI=1S/C9H14N2O5S2/c1-11(17(3,12)13)8-6-7(18(10,14)15)4-5-9(8)16-2/h4-6H,1-3H3,(H2,10,14,15) |
| InChIKey | DBFKEKMFAUATHI-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |