C19H25N3O6S2 — CID 44654174
N-benzyl-3-[[4-methoxy-3-[methyl(methylsulfonyl)amino]phenyl]sulfonylamino]propanamide (PubChem CID 44654174) has the molecular formula C19H25N3O6S2 and a molecular weight of 455.56 g/mol. Its IUPAC name is N-benzyl-3-[[4-methoxy-3-[methyl(methylsulfonyl)amino]phenyl]sulfonylamino]propanamide.
| Compound Name | N-benzyl-3-[[4-methoxy-3-[methyl(methylsulfonyl)amino]phenyl]sulfonylamino]propanamide |
|---|---|
| PubChem CID | 44654174 |
| Molecular Formula | C19H25N3O6S2 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | N-benzyl-3-[[4-methoxy-3-[methyl(methylsulfonyl)amino]phenyl]sulfonylamino]propanamide |
| SMILES | COc1ccc(S(=O)(=O)NCCC(=O)NCc2ccccc2)cc1N(C)S(C)(=O)=O |
| InChI | InChI=1S/C19H25N3O6S2/c1-22(29(3,24)25)17-13-16(9-10-18(17)28-2)30(26,27)21-12-11-19(23)20-14-15-7-5-4-6-8-15/h4-10,13,21H,11-12,14H2,1-3H3,(H,20,23) |
| InChIKey | NFUCLTISAUEDPB-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |