C20H27N3O7S2 — CID 71945662
3-[[3-[benzenesulfonyl(methyl)amino]-4-methoxyphenyl]sulfonylamino]-N-(2-methoxyethyl)propanamide (PubChem CID 71945662) has the molecular formula C20H27N3O7S2 and a molecular weight of 485.58 g/mol. Its IUPAC name is 3-[[3-[benzenesulfonyl(methyl)amino]-4-methoxyphenyl]sulfonylamino]-N-(2-methoxyethyl)propanamide.
| Compound Name | 3-[[3-[benzenesulfonyl(methyl)amino]-4-methoxyphenyl]sulfonylamino]-N-(2-methoxyethyl)propanamide |
|---|---|
| PubChem CID | 71945662 |
| Molecular Formula | C20H27N3O7S2 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | 3-[[3-[benzenesulfonyl(methyl)amino]-4-methoxyphenyl]sulfonylamino]-N-(2-methoxyethyl)propanamide |
| SMILES | COCCNC(=O)CCNS(=O)(=O)c1ccc(OC)c(N(C)S(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C20H27N3O7S2/c1-23(32(27,28)16-7-5-4-6-8-16)18-15-17(9-10-19(18)30-3)31(25,26)22-12-11-20(24)21-13-14-29-2/h4-10,15,22H,11-14H2,1-3H3,(H,21,24) |
| InChIKey | WYYROZYHYYHVOT-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|