C12H10F7NO — CID 131997492
2,2,3,3-tetrafluoro-N-methyl-N-[(2,3,5-trifluorophenyl)methyl]butanamide (PubChem CID 131997492) has the molecular formula C12H10F7NO and a molecular weight of 317.20 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-N-methyl-N-[(2,3,5-trifluorophenyl)methyl]butanamide.
| Compound Name | 2,2,3,3-tetrafluoro-N-methyl-N-[(2,3,5-trifluorophenyl)methyl]butanamide |
|---|---|
| PubChem CID | 131997492 |
| Molecular Formula | C12H10F7NO |
| Molecular Weight | 317.20 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | 2,2,3,3-tetrafluoro-N-methyl-N-[(2,3,5-trifluorophenyl)methyl]butanamide |
| SMILES | CN(Cc1cc(F)cc(F)c1F)C(=O)C(F)(F)C(C)(F)F |
| InChI | InChI=1S/C12H10F7NO/c1-11(16,17)12(18,19)10(21)20(2)5-6-3-7(13)4-8(14)9(6)15/h3-4H,5H2,1-2H3 |
| InChIKey | UYCTVUJCTGNHJX-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.20 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|