C15H21N3O2 — CID 62837775
3-(ethylamino)-N-(2-ethyl-1,3-benzoxazol-5-yl)butanamide (PubChem CID 62837775) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is 3-(ethylamino)-N-(2-ethyl-1,3-benzoxazol-5-yl)butanamide.
| Compound Name | 3-(ethylamino)-N-(2-ethyl-1,3-benzoxazol-5-yl)butanamide |
|---|---|
| PubChem CID | 62837775 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | 3-(ethylamino)-N-(2-ethyl-1,3-benzoxazol-5-yl)butanamide |
| SMILES | CCNC(C)CC(=O)Nc1ccc2oc(CC)nc2c1 |
| InChI | InChI=1S/C15H21N3O2/c1-4-15-18-12-9-11(6-7-13(12)20-15)17-14(19)8-10(3)16-5-2/h6-7,9-10,16H,4-5,8H2,1-3H3,(H,17,19) |
| InChIKey | HISZPEYYNKWYMS-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |