C12H14N4O — CID 13373822
3-[amino-(5-ethyl-1,3-benzoxazol-2-yl)amino]propanenitrile (PubChem CID 13373822) has the molecular formula C12H14N4O and a molecular weight of 230.27 g/mol. Its IUPAC name is 3-[amino-(5-ethyl-1,3-benzoxazol-2-yl)amino]propanenitrile.
| Compound Name | 3-[amino-(5-ethyl-1,3-benzoxazol-2-yl)amino]propanenitrile |
|---|---|
| PubChem CID | 13373822 |
| Molecular Formula | C12H14N4O |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | 3-[amino-(5-ethyl-1,3-benzoxazol-2-yl)amino]propanenitrile |
| SMILES | CCc1ccc2oc(N(N)CCC#N)nc2c1 |
| InChI | InChI=1S/C12H14N4O/c1-2-9-4-5-11-10(8-9)15-12(17-11)16(14)7-3-6-13/h4-5,8H,2-3,7,14H2,1H3 |
| InChIKey | ORAHDFSYKXNOQB-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 79.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|