C11H12N4O — CID 13373834
3-[amino(1,3-benzoxazol-2-yl)amino]butanenitrile (PubChem CID 13373834) has the molecular formula C11H12N4O and a molecular weight of 216.24 g/mol. Its IUPAC name is 3-[amino(1,3-benzoxazol-2-yl)amino]butanenitrile.
| Compound Name | 3-[amino(1,3-benzoxazol-2-yl)amino]butanenitrile |
|---|---|
| PubChem CID | 13373834 |
| Molecular Formula | C11H12N4O |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | 3-[amino(1,3-benzoxazol-2-yl)amino]butanenitrile |
| SMILES | CC(CC#N)N(N)c1nc2ccccc2o1 |
| InChI | InChI=1S/C11H12N4O/c1-8(6-7-12)15(13)11-14-9-4-2-3-5-10(9)16-11/h2-5,8H,6,13H2,1H3 |
| InChIKey | PVKHGRDZZVZRPD-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 79.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|