C17H18FN3O3 — CID 71459129
5-[5-[2-(2-fluoroethoxy)ethoxy]-1,3-benzoxazol-2-yl]-N-methylpyridin-2-amine (PubChem CID 71459129) has the molecular formula C17H18FN3O3 and a molecular weight of 331.35 g/mol. Its IUPAC name is 5-[5-[2-(2-fluoroethoxy)ethoxy]-1,3-benzoxazol-2-yl]-N-methylpyridin-2-amine.
| Compound Name | 5-[5-[2-(2-fluoroethoxy)ethoxy]-1,3-benzoxazol-2-yl]-N-methylpyridin-2-amine |
|---|---|
| PubChem CID | 71459129 |
| Molecular Formula | C17H18FN3O3 |
| Molecular Weight | 331.35 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | 5-[5-[2-(2-fluoroethoxy)ethoxy]-1,3-benzoxazol-2-yl]-N-methylpyridin-2-amine |
| SMILES | CNc1ccc(-c2nc3cc(OCCOCCF)ccc3o2)cn1 |
| InChI | InChI=1S/C17H18FN3O3/c1-19-16-5-2-12(11-20-16)17-21-14-10-13(3-4-15(14)24-17)23-9-8-22-7-6-18/h2-5,10-11H,6-9H2,1H3,(H,19,20) |
| InChIKey | DCYAMBGYXCNVQZ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 69.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.35 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|