C26H38N2OSn — CID 20625606
N-methyl-4-(6-tributylstannyl-1,3-benzoxazol-2-yl)aniline (PubChem CID 20625606) has the molecular formula C26H38N2OSn and a molecular weight of 513.31 g/mol. Its IUPAC name is N-methyl-4-(6-tributylstannyl-1,3-benzoxazol-2-yl)aniline.
| Compound Name | N-methyl-4-(6-tributylstannyl-1,3-benzoxazol-2-yl)aniline |
|---|---|
| PubChem CID | 20625606 |
| Molecular Formula | C26H38N2OSn |
| Molecular Weight | 513.31 g/mol |
| Exact Mass | 514.20 |
| IUPAC Name | N-methyl-4-(6-tributylstannyl-1,3-benzoxazol-2-yl)aniline |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1ccc2nc(-c3ccc(NC)cc3)oc2c1 |
| InChI | InChI=1S/C14H11N2O.3C4H9.Sn/c1-15-11-8-6-10(7-9-11)14-16-12-4-2-3-5-13(12)17-14;3*1-3-4-2;/h2,4-9,15H,1H3;3*1,3-4H2,2H3; |
| InChIKey | ZDGIXULYGPEBEZ-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.31 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |