C27H37NOSn — CID 177401791
tributyl-[2-[(E)-2-phenylethenyl]-1,3-benzoxazol-6-yl]stannane (PubChem CID 177401791) has the molecular formula C27H37NOSn and a molecular weight of 510.31 g/mol. Its IUPAC name is tributyl-[2-[(E)-2-phenylethenyl]-1,3-benzoxazol-6-yl]stannane.
| Compound Name | tributyl-[2-[(E)-2-phenylethenyl]-1,3-benzoxazol-6-yl]stannane |
|---|---|
| PubChem CID | 177401791 |
| Molecular Formula | C27H37NOSn |
| Molecular Weight | 510.31 g/mol |
| Exact Mass | 511.19 |
| IUPAC Name | tributyl-[2-[(E)-2-phenylethenyl]-1,3-benzoxazol-6-yl]stannane |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1ccc2nc(/C=C/c3ccccc3)oc2c1 |
| InChI | InChI=1S/C15H10NO.3C4H9.Sn/c1-2-6-12(7-3-1)10-11-15-16-13-8-4-5-9-14(13)17-15;3*1-3-4-2;/h1-4,6-11H;3*1,3-4H2,2H3;/b11-10+;;;; |
| InChIKey | HUBFPUGKQATWEC-RKKUYNIKSA-N |
| XLogP | 8.05 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.31 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |