C17H18FN3O — CID 154979858
4-[(E)-[(E)-[4-(2-fluoroethoxy)phenyl]methylidenehydrazinylidene]methyl]-N-methylaniline (PubChem CID 154979858) has the molecular formula C17H18FN3O and a molecular weight of 299.35 g/mol. Its IUPAC name is 4-[(E)-[(E)-[4-(2-fluoroethoxy)phenyl]methylidenehydrazinylidene]methyl]-N-methylaniline.
| Compound Name | 4-[(E)-[(E)-[4-(2-fluoroethoxy)phenyl]methylidenehydrazinylidene]methyl]-N-methylaniline |
|---|---|
| PubChem CID | 154979858 |
| Molecular Formula | C17H18FN3O |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 4-[(E)-[(E)-[4-(2-fluoroethoxy)phenyl]methylidenehydrazinylidene]methyl]-N-methylaniline |
| SMILES | CNc1ccc(/C=N/N=C/c2ccc(OCCF)cc2)cc1 |
| InChI | InChI=1S/C17H18FN3O/c1-19-16-6-2-14(3-7-16)12-20-21-13-15-4-8-17(9-5-15)22-11-10-18/h2-9,12-13,19H,10-11H2,1H3/b20-12+,21-13+ |
| InChIKey | KCOWWIHUTBCHKL-ZIOPAAQOSA-N |
| XLogP | 3.53 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|