C22H29FN2O3 — CID 177390012
4-[(E)-2-[6-[2-[2-(2-(18F)fluoroethoxy)ethoxy]ethoxymethyl]-3-pyridinyl]ethenyl]-N,N-dimethyl(18F)aniline (PubChem CID 177390012) has the molecular formula C22H29FN2O3 and a molecular weight of 387.49 g/mol. Its IUPAC name is 4-[(E)-2-[6-[2-[2-(2-(18F)fluoroethoxy)ethoxy]ethoxymethyl]-3-pyridinyl]ethenyl]-N,N-dimethyl(18F)aniline.
| Compound Name | 4-[(E)-2-[6-[2-[2-(2-(18F)fluoroethoxy)ethoxy]ethoxymethyl]-3-pyridinyl]ethenyl]-N,N-dimethyl(18F)aniline |
|---|---|
| PubChem CID | 177390012 |
| Molecular Formula | C22H29FN2O3 |
| Molecular Weight | 387.49 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | 4-[(E)-2-[6-[2-[2-(2-(18F)fluoroethoxy)ethoxy]ethoxymethyl]-3-pyridinyl]ethenyl]-N,N-dimethyl(18F)aniline |
| SMILES | CN(C)c1ccc(/C=C/c2ccc(COCCOCCOCC[18F])nc2)cc1 |
| InChI | InChI=1S/C22H29FN2O3/c1-25(2)22-9-6-19(7-10-22)3-4-20-5-8-21(24-17-20)18-28-16-15-27-14-13-26-12-11-23/h3-10,17H,11-16,18H2,1-2H3/b4-3+/i23-1 |
| InChIKey | LTIOAQIWVQYIFY-GMBLAFOMSA-N |
| XLogP | 3.84 |
| TPSA | 43.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.49 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|