C21H35NO6 — CID 135278255
tert-butyl 2-[2-[2-[2-(4-ethoxyphenoxy)ethyl-methylamino]ethoxy]ethoxy]acetate (PubChem CID 135278255) has the molecular formula C21H35NO6 and a molecular weight of 397.51 g/mol. Its IUPAC name is tert-butyl 2-[2-[2-[2-(4-ethoxyphenoxy)ethyl-methylamino]ethoxy]ethoxy]acetate.
| Compound Name | tert-butyl 2-[2-[2-[2-(4-ethoxyphenoxy)ethyl-methylamino]ethoxy]ethoxy]acetate |
|---|---|
| PubChem CID | 135278255 |
| Molecular Formula | C21H35NO6 |
| Molecular Weight | 397.51 g/mol |
| Exact Mass | 397.25 |
| IUPAC Name | tert-butyl 2-[2-[2-[2-(4-ethoxyphenoxy)ethyl-methylamino]ethoxy]ethoxy]acetate |
| SMILES | CCOc1ccc(OCCN(C)CCOCCOCC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C21H35NO6/c1-6-26-18-7-9-19(10-8-18)27-14-12-22(5)11-13-24-15-16-25-17-20(23)28-21(2,3)4/h7-10H,6,11-17H2,1-5H3 |
| InChIKey | OYSSLTIWPKVMAY-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.51 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|