C19H26N2O7S — CID 177203858
tert-butyl 2-[2-[2-[4-(5-methylsulfinyl-1,3,4-oxadiazol-2-yl)phenoxy]ethoxy]ethoxy]acetate (PubChem CID 177203858) has the molecular formula C19H26N2O7S and a molecular weight of 426.49 g/mol. Its IUPAC name is tert-butyl 2-[2-[2-[4-(5-methylsulfinyl-1,3,4-oxadiazol-2-yl)phenoxy]ethoxy]ethoxy]acetate.
| Compound Name | tert-butyl 2-[2-[2-[4-(5-methylsulfinyl-1,3,4-oxadiazol-2-yl)phenoxy]ethoxy]ethoxy]acetate |
|---|---|
| PubChem CID | 177203858 |
| Molecular Formula | C19H26N2O7S |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | tert-butyl 2-[2-[2-[4-(5-methylsulfinyl-1,3,4-oxadiazol-2-yl)phenoxy]ethoxy]ethoxy]acetate |
| SMILES | CS(=O)c1nnc(-c2ccc(OCCOCCOCC(=O)OC(C)(C)C)cc2)o1 |
| InChI | InChI=1S/C19H26N2O7S/c1-19(2,3)28-16(22)13-25-10-9-24-11-12-26-15-7-5-14(6-8-15)17-20-21-18(27-17)29(4)23/h5-8H,9-13H2,1-4H3 |
| InChIKey | FYWBXDZXDPNTKD-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 109.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|