C21H34BrNO8 — CID 134481656
tert-butyl 2-[2-[2-[2-[2-[2-[(5-bromo-2-pyridinyl)oxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetate (PubChem CID 134481656) has the molecular formula C21H34BrNO8 and a molecular weight of 508.41 g/mol. Its IUPAC name is tert-butyl 2-[2-[2-[2-[2-[2-[(5-bromo-2-pyridinyl)oxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetate.
| Compound Name | tert-butyl 2-[2-[2-[2-[2-[2-[(5-bromo-2-pyridinyl)oxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetate |
|---|---|
| PubChem CID | 134481656 |
| Molecular Formula | C21H34BrNO8 |
| Molecular Weight | 508.41 g/mol |
| Exact Mass | 507.15 |
| IUPAC Name | tert-butyl 2-[2-[2-[2-[2-[2-[(5-bromo-2-pyridinyl)oxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetate |
| SMILES | CC(C)(C)OC(=O)COCCOCCOCCOCCOCCOc1ccc(Br)cn1 |
| InChI | InChI=1S/C21H34BrNO8/c1-21(2,3)31-20(24)17-29-13-12-27-9-8-25-6-7-26-10-11-28-14-15-30-19-5-4-18(22)16-23-19/h4-5,16H,6-15,17H2,1-3H3 |
| InChIKey | KLNRJXBQZXUHGR-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 94.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.41 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|