C36H48N2O8 — CID 155584832
tert-butyl 2-[2-[2-[2-[2-[2-[[5-(4-azatricyclo[10.4.0.02,7]hexadeca-1(12),2(7),3,5,13,15-hexaen-14-yl)-2-pyridinyl]oxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetate (PubChem CID 155584832) has the molecular formula C36H48N2O8 and a molecular weight of 636.79 g/mol. Its IUPAC name is tert-butyl 2-[2-[2-[2-[2-[2-[[5-(4-azatricyclo[10.4.0.02,7]hexadeca-1(12),2(7),3,5,13,15-hexaen-14-yl)-2-pyridinyl]oxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetate.
| Compound Name | tert-butyl 2-[2-[2-[2-[2-[2-[[5-(4-azatricyclo[10.4.0.02,7]hexadeca-1(12),2(7),3,5,13,15-hexaen-14-yl)-2-pyridinyl]oxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetate |
|---|---|
| PubChem CID | 155584832 |
| Molecular Formula | C36H48N2O8 |
| Molecular Weight | 636.79 g/mol |
| Exact Mass | 636.34 |
| IUPAC Name | tert-butyl 2-[2-[2-[2-[2-[2-[[5-(4-azatricyclo[10.4.0.02,7]hexadeca-1(12),2(7),3,5,13,15-hexaen-14-yl)-2-pyridinyl]oxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetate |
| SMILES | CC(C)(C)OC(=O)COCCOCCOCCOCCOCCOc1ccc(-c2ccc3c(c2)CCCCc2ccncc2-3)cn1 |
| InChI | InChI=1S/C36H48N2O8/c1-36(2,3)46-35(39)27-44-21-20-42-17-16-40-14-15-41-18-19-43-22-23-45-34-11-9-31(25-38-34)29-8-10-32-30(24-29)7-5-4-6-28-12-13-37-26-33(28)32/h8-13,24-26H,4-7,14-23,27H2,1-3H3 |
| InChIKey | LYOPQUOYVAOEPM-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 107.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.79 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|