C21H30N2O5S — CID 177203810
3-methyl-1-[2-[2-[4-(5-propylsulfanyl-1,3,4-oxadiazol-2-yl)phenoxy]ethoxy]ethoxy]pentan-2-one (PubChem CID 177203810) has the molecular formula C21H30N2O5S and a molecular weight of 422.55 g/mol. Its IUPAC name is 3-methyl-1-[2-[2-[4-(5-propylsulfanyl-1,3,4-oxadiazol-2-yl)phenoxy]ethoxy]ethoxy]pentan-2-one.
| Compound Name | 3-methyl-1-[2-[2-[4-(5-propylsulfanyl-1,3,4-oxadiazol-2-yl)phenoxy]ethoxy]ethoxy]pentan-2-one |
|---|---|
| PubChem CID | 177203810 |
| Molecular Formula | C21H30N2O5S |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | 3-methyl-1-[2-[2-[4-(5-propylsulfanyl-1,3,4-oxadiazol-2-yl)phenoxy]ethoxy]ethoxy]pentan-2-one |
| SMILES | CCCSc1nnc(-c2ccc(OCCOCCOCC(=O)C(C)CC)cc2)o1 |
| InChI | InChI=1S/C21H30N2O5S/c1-4-14-29-21-23-22-20(28-21)17-6-8-18(9-7-17)27-13-12-25-10-11-26-15-19(24)16(3)5-2/h6-9,16H,4-5,10-15H2,1-3H3 |
| InChIKey | JKBDBQMIAOJNMU-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 83.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|