C12H15N3O3S — CID 178135678
N-methyl-2-[4-(5-methylsulfinyl-1,3,4-oxadiazol-2-yl)phenoxy]ethanamine (PubChem CID 178135678) has the molecular formula C12H15N3O3S and a molecular weight of 281.34 g/mol. Its IUPAC name is N-methyl-2-[4-(5-methylsulfinyl-1,3,4-oxadiazol-2-yl)phenoxy]ethanamine.
| Compound Name | N-methyl-2-[4-(5-methylsulfinyl-1,3,4-oxadiazol-2-yl)phenoxy]ethanamine |
|---|---|
| PubChem CID | 178135678 |
| Molecular Formula | C12H15N3O3S |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | N-methyl-2-[4-(5-methylsulfinyl-1,3,4-oxadiazol-2-yl)phenoxy]ethanamine |
| SMILES | CNCCOc1ccc(-c2nnc(S(C)=O)o2)cc1 |
| InChI | InChI=1S/C12H15N3O3S/c1-13-7-8-17-10-5-3-9(4-6-10)11-14-15-12(18-11)19(2)16/h3-6,13H,7-8H2,1-2H3 |
| InChIKey | WFMDQXVXWSKOIM-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|