C26H30N2O3 — CID 57160867
2,5-bis(4-hex-3-enoxyphenyl)-1,3,4-oxadiazole (PubChem CID 57160867) has the molecular formula C26H30N2O3 and a molecular weight of 418.54 g/mol. Its IUPAC name is 2,5-bis(4-hex-3-enoxyphenyl)-1,3,4-oxadiazole.
| Compound Name | 2,5-bis(4-hex-3-enoxyphenyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 57160867 |
| Molecular Formula | C26H30N2O3 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | 2,5-bis(4-hex-3-enoxyphenyl)-1,3,4-oxadiazole |
| SMILES | CCC=CCCOc1ccc(-c2nnc(-c3ccc(OCCC=CCC)cc3)o2)cc1 |
| InChI | InChI=1S/C26H30N2O3/c1-3-5-7-9-19-29-23-15-11-21(12-16-23)25-27-28-26(31-25)22-13-17-24(18-14-22)30-20-10-8-6-4-2/h5-8,11-18H,3-4,9-10,19-20H2,1-2H3 |
| InChIKey | BHMHTCLHESVLRO-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 57.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|