C18H17ClN2O2 — CID 71406447
2-[4-(4-chlorobutoxy)phenyl]-5-phenyl-1,3,4-oxadiazole (PubChem CID 71406447) has the molecular formula C18H17ClN2O2 and a molecular weight of 328.80 g/mol. Its IUPAC name is 2-[4-(4-chlorobutoxy)phenyl]-5-phenyl-1,3,4-oxadiazole.
| Compound Name | 2-[4-(4-chlorobutoxy)phenyl]-5-phenyl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 71406447 |
| Molecular Formula | C18H17ClN2O2 |
| Molecular Weight | 328.80 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | 2-[4-(4-chlorobutoxy)phenyl]-5-phenyl-1,3,4-oxadiazole |
| SMILES | ClCCCCOc1ccc(-c2nnc(-c3ccccc3)o2)cc1 |
| InChI | InChI=1S/C18H17ClN2O2/c19-12-4-5-13-22-16-10-8-15(9-11-16)18-21-20-17(23-18)14-6-2-1-3-7-14/h1-3,6-11H,4-5,12-13H2 |
| InChIKey | NEMOVBXDJNGDNK-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.80 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|