C21H32O6 — CID 23063072
6-oxo-6-[2-[2-(1-phenylpentan-2-yloxy)ethoxy]ethoxy]hexanoic acid (PubChem CID 23063072) has the molecular formula C21H32O6 and a molecular weight of 380.48 g/mol. Its IUPAC name is 6-oxo-6-[2-[2-(1-phenylpentan-2-yloxy)ethoxy]ethoxy]hexanoic acid.
| Compound Name | 6-oxo-6-[2-[2-(1-phenylpentan-2-yloxy)ethoxy]ethoxy]hexanoic acid |
|---|---|
| PubChem CID | 23063072 |
| Molecular Formula | C21H32O6 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | 6-oxo-6-[2-[2-(1-phenylpentan-2-yloxy)ethoxy]ethoxy]hexanoic acid |
| SMILES | CCCC(Cc1ccccc1)OCCOCCOC(=O)CCCCC(=O)O |
| InChI | InChI=1S/C21H32O6/c1-2-8-19(17-18-9-4-3-5-10-18)26-15-13-25-14-16-27-21(24)12-7-6-11-20(22)23/h3-5,9-10,19H,2,6-8,11-17H2,1H3,(H,22,23) |
| InChIKey | DGMNKTIAOFKXGP-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|