C17H23F2N3O2 — CID 118648223
1-[2-(3,5-difluoro-4-piperazin-1-ylphenoxy)ethyl]piperidin-2-one (PubChem CID 118648223) has the molecular formula C17H23F2N3O2 and a molecular weight of 339.39 g/mol. Its IUPAC name is 1-[2-(3,5-difluoro-4-piperazin-1-ylphenoxy)ethyl]piperidin-2-one.
| Compound Name | 1-[2-(3,5-difluoro-4-piperazin-1-ylphenoxy)ethyl]piperidin-2-one |
|---|---|
| PubChem CID | 118648223 |
| Molecular Formula | C17H23F2N3O2 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | 1-[2-(3,5-difluoro-4-piperazin-1-ylphenoxy)ethyl]piperidin-2-one |
| SMILES | O=C1CCCCN1CCOc1cc(F)c(N2CCNCC2)c(F)c1 |
| InChI | InChI=1S/C17H23F2N3O2/c18-14-11-13(24-10-9-21-6-2-1-3-16(21)23)12-15(19)17(14)22-7-4-20-5-8-22/h11-12,20H,1-10H2 |
| InChIKey | NIRWUJHIGOCMEV-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|