C12H11ClF3NO — CID 118905081
(3S,4R)-6-(4-chloro-2,6-difluorophenyl)-4-fluoro-1-oxa-6-azaspiro[2.5]octane (PubChem CID 118905081) has the molecular formula C12H11ClF3NO and a molecular weight of 277.67 g/mol. Its IUPAC name is (3S,4R)-6-(4-chloro-2,6-difluorophenyl)-4-fluoro-1-oxa-6-azaspiro[2.5]octane.
| Compound Name | (3S,4R)-6-(4-chloro-2,6-difluorophenyl)-4-fluoro-1-oxa-6-azaspiro[2.5]octane |
|---|---|
| PubChem CID | 118905081 |
| Molecular Formula | C12H11ClF3NO |
| Molecular Weight | 277.67 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | (3S,4R)-6-(4-chloro-2,6-difluorophenyl)-4-fluoro-1-oxa-6-azaspiro[2.5]octane |
| SMILES | Fc1cc(Cl)cc(F)c1N1CC[C@]2(CO2)[C@H](F)C1 |
| InChI | InChI=1S/C12H11ClF3NO/c13-7-3-8(14)11(9(15)4-7)17-2-1-12(6-18-12)10(16)5-17/h3-4,10H,1-2,5-6H2/t10-,12+/m1/s1 |
| InChIKey | MCOGTPNZQOAPGV-PWSUYJOCSA-N |
| XLogP | 2.94 |
| TPSA | 15.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.67 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|