C20H20ClF2NO3 — CID 118903988
(3S,4R)-6-(4-chloro-2,6-difluorophenyl)-4-[(4-methoxyphenyl)methoxy]-1-oxa-6-azaspiro[2.5]octane (PubChem CID 118903988) has the molecular formula C20H20ClF2NO3 and a molecular weight of 395.83 g/mol. Its IUPAC name is (3S,4R)-6-(4-chloro-2,6-difluorophenyl)-4-[(4-methoxyphenyl)methoxy]-1-oxa-6-azaspiro[2.5]octane.
| Compound Name | (3S,4R)-6-(4-chloro-2,6-difluorophenyl)-4-[(4-methoxyphenyl)methoxy]-1-oxa-6-azaspiro[2.5]octane |
|---|---|
| PubChem CID | 118903988 |
| Molecular Formula | C20H20ClF2NO3 |
| Molecular Weight | 395.83 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | (3S,4R)-6-(4-chloro-2,6-difluorophenyl)-4-[(4-methoxyphenyl)methoxy]-1-oxa-6-azaspiro[2.5]octane |
| SMILES | COc1ccc(CO[C@@H]2CN(c3c(F)cc(Cl)cc3F)CC[C@]23CO3)cc1 |
| InChI | InChI=1S/C20H20ClF2NO3/c1-25-15-4-2-13(3-5-15)11-26-18-10-24(7-6-20(18)12-27-20)19-16(22)8-14(21)9-17(19)23/h2-5,8-9,18H,6-7,10-12H2,1H3/t18-,20+/m1/s1 |
| InChIKey | PYOVSYVEVRACIE-QUCCMNQESA-N |
| XLogP | 4.19 |
| TPSA | 34.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.83 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|