C20H21ClNO5- — CID 22126807
4-(4-chlorophenyl)-4-hydroxy-3-[(4-methoxyphenyl)methoxy]piperidine-1-carboxylate (PubChem CID 22126807) has the molecular formula C20H21ClNO5- and a molecular weight of 390.84 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-4-hydroxy-3-[(4-methoxyphenyl)methoxy]piperidine-1-carboxylate.
| Compound Name | 4-(4-chlorophenyl)-4-hydroxy-3-[(4-methoxyphenyl)methoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 22126807 |
| Molecular Formula | C20H21ClNO5- |
| Molecular Weight | 390.84 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | 4-(4-chlorophenyl)-4-hydroxy-3-[(4-methoxyphenyl)methoxy]piperidine-1-carboxylate |
| SMILES | COc1ccc(COC2CN(C(=O)[O-])CCC2(O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C20H22ClNO5/c1-26-17-8-2-14(3-9-17)13-27-18-12-22(19(23)24)11-10-20(18,25)15-4-6-16(21)7-5-15/h2-9,18,25H,10-13H2,1H3,(H,23,24)/p-1 |
| InChIKey | LAARAUFNPCHZTI-UHFFFAOYSA-M |
| XLogP | 2.17 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.84 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |