C15H23ClFN3 — CID 103552997
4-(4-tert-butylpiperidin-1-yl)-6-chloro-5-fluorobenzene-1,3-diamine (PubChem CID 103552997) has the molecular formula C15H23ClFN3 and a molecular weight of 299.82 g/mol. Its IUPAC name is 4-(4-tert-butylpiperidin-1-yl)-6-chloro-5-fluorobenzene-1,3-diamine.
| Compound Name | 4-(4-tert-butylpiperidin-1-yl)-6-chloro-5-fluorobenzene-1,3-diamine |
|---|---|
| PubChem CID | 103552997 |
| Molecular Formula | C15H23ClFN3 |
| Molecular Weight | 299.82 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | 4-(4-tert-butylpiperidin-1-yl)-6-chloro-5-fluorobenzene-1,3-diamine |
| SMILES | CC(C)(C)C1CCN(c2c(N)cc(N)c(Cl)c2F)CC1 |
| InChI | InChI=1S/C15H23ClFN3/c1-15(2,3)9-4-6-20(7-5-9)14-11(19)8-10(18)12(16)13(14)17/h8-9H,4-7,18-19H2,1-3H3 |
| InChIKey | IJAATGBPADTUIY-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.82 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|