C13H19ClFN3O — CID 103552889
4-chloro-6-(3-ethoxypiperidin-1-yl)-5-fluorobenzene-1,3-diamine (PubChem CID 103552889) has the molecular formula C13H19ClFN3O and a molecular weight of 287.77 g/mol. Its IUPAC name is 4-chloro-6-(3-ethoxypiperidin-1-yl)-5-fluorobenzene-1,3-diamine.
| Compound Name | 4-chloro-6-(3-ethoxypiperidin-1-yl)-5-fluorobenzene-1,3-diamine |
|---|---|
| PubChem CID | 103552889 |
| Molecular Formula | C13H19ClFN3O |
| Molecular Weight | 287.77 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 4-chloro-6-(3-ethoxypiperidin-1-yl)-5-fluorobenzene-1,3-diamine |
| SMILES | CCOC1CCCN(c2c(N)cc(N)c(Cl)c2F)C1 |
| InChI | InChI=1S/C13H19ClFN3O/c1-2-19-8-4-3-5-18(7-8)13-10(17)6-9(16)11(14)12(13)15/h6,8H,2-5,7,16-17H2,1H3 |
| InChIKey | VNGCTCCUBOMWOE-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 64.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.77 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|