C12H17ClFN3O — CID 103553396
1-[1-(4,6-diamino-3-chloro-2-fluorophenyl)pyrrolidin-3-yl]ethanol (PubChem CID 103553396) has the molecular formula C12H17ClFN3O and a molecular weight of 273.74 g/mol. Its IUPAC name is 1-[1-(4,6-diamino-3-chloro-2-fluorophenyl)pyrrolidin-3-yl]ethanol.
| Compound Name | 1-[1-(4,6-diamino-3-chloro-2-fluorophenyl)pyrrolidin-3-yl]ethanol |
|---|---|
| PubChem CID | 103553396 |
| Molecular Formula | C12H17ClFN3O |
| Molecular Weight | 273.74 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 1-[1-(4,6-diamino-3-chloro-2-fluorophenyl)pyrrolidin-3-yl]ethanol |
| SMILES | CC(O)C1CCN(c2c(N)cc(N)c(Cl)c2F)C1 |
| InChI | InChI=1S/C12H17ClFN3O/c1-6(18)7-2-3-17(5-7)12-9(16)4-8(15)10(13)11(12)14/h4,6-7,18H,2-3,5,15-16H2,1H3 |
| InChIKey | ZIPGIIILNACDBZ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 75.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.74 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|