About 4-(3-ethoxypiperidin-1-yl)-3,5-difluorobenzaldehyde
4-(3-ethoxypiperidin-1-yl)-3,5-difluorobenzaldehyde (PubChem CID 55146964) has the molecular formula C14H17F2NO2
and a molecular weight of 269.29 g/mol. Its IUPAC name is 4-(3-ethoxypiperidin-1-yl)-3,5-difluorobenzaldehyde.
Molecular Properties
| Compound Name | 4-(3-ethoxypiperidin-1-yl)-3,5-difluorobenzaldehyde |
| PubChem CID | 55146964 |
| Molecular Formula | C14H17F2NO2 |
| Molecular Weight | 269.29 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 4-(3-ethoxypiperidin-1-yl)-3,5-difluorobenzaldehyde |
| SMILES | CCOC1CCCN(c2c(F)cc(C=O)cc2F)C1 |
| InChI | InChI=1S/C14H17F2NO2/c1-2-19-11-4-3-5-17(8-11)14-12(15)6-10(9-18)7-13(14)16/h6-7,9,11H,2-5,8H2,1H3 |
| InChIKey | SUIGKFBNPXGLMG-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.29 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-ethoxypiperidin-1-yl)-3,5-difluorobenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-ethoxypiperidin-1-yl)-3,5-difluorobenzaldehyde?
The IUPAC name of 4-(3-ethoxypiperidin-1-yl)-3,5-difluorobenzaldehyde (CID 55146964) is 4-(3-ethoxypiperidin-1-yl)-3,5-difluorobenzaldehyde.
What is the SMILES notation for 4-(3-ethoxypiperidin-1-yl)-3,5-difluorobenzaldehyde?
The canonical SMILES for 4-(3-ethoxypiperidin-1-yl)-3,5-difluorobenzaldehyde is CCOC1CCCN(c2c(F)cc(C=O)cc2F)C1.
What is the InChIKey of 4-(3-ethoxypiperidin-1-yl)-3,5-difluorobenzaldehyde?
The InChIKey is SUIGKFBNPXGLMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17F2NO2/c1-2-19-11-4-3-5-17(8-11)14-12(15)6-10(9-18)7-13(14)16/h6-7,9,11H,2-5,8H2,1H3.
What are the key properties of 4-(3-ethoxypiperidin-1-yl)-3,5-difluorobenzaldehyde?
4-(3-ethoxypiperidin-1-yl)-3,5-difluorobenzaldehyde has a molecular weight of 269.29 g/mol, XLogP of 2.78, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-ethoxypiperidin-1-yl)-3,5-difluorobenzaldehyde is sourced from PubChem (CID 55146964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).