C11H14ClFN4O — CID 103552483
1-(4,6-diamino-3-chloro-2-fluorophenyl)pyrrolidine-2-carboxamide (PubChem CID 103552483) has the molecular formula C11H14ClFN4O and a molecular weight of 272.71 g/mol. Its IUPAC name is 1-(4,6-diamino-3-chloro-2-fluorophenyl)pyrrolidine-2-carboxamide.
| Compound Name | 1-(4,6-diamino-3-chloro-2-fluorophenyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 103552483 |
| Molecular Formula | C11H14ClFN4O |
| Molecular Weight | 272.71 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 1-(4,6-diamino-3-chloro-2-fluorophenyl)pyrrolidine-2-carboxamide |
| SMILES | NC(=O)C1CCCN1c1c(N)cc(N)c(Cl)c1F |
| InChI | InChI=1S/C11H14ClFN4O/c12-8-5(14)4-6(15)10(9(8)13)17-3-1-2-7(17)11(16)18/h4,7H,1-3,14-15H2,(H2,16,18) |
| InChIKey | UNZFJLSKSRWQEX-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 98.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.71 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|