C13H18ClFN4O — CID 103552707
1-(4,6-diamino-3-chloro-2-fluorophenyl)-N,N-dimethylpyrrolidine-2-carboxamide (PubChem CID 103552707) has the molecular formula C13H18ClFN4O and a molecular weight of 300.77 g/mol. Its IUPAC name is 1-(4,6-diamino-3-chloro-2-fluorophenyl)-N,N-dimethylpyrrolidine-2-carboxamide.
| Compound Name | 1-(4,6-diamino-3-chloro-2-fluorophenyl)-N,N-dimethylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 103552707 |
| Molecular Formula | C13H18ClFN4O |
| Molecular Weight | 300.77 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 1-(4,6-diamino-3-chloro-2-fluorophenyl)-N,N-dimethylpyrrolidine-2-carboxamide |
| SMILES | CN(C)C(=O)C1CCCN1c1c(N)cc(N)c(Cl)c1F |
| InChI | InChI=1S/C13H18ClFN4O/c1-18(2)13(20)9-4-3-5-19(9)12-8(17)6-7(16)10(14)11(12)15/h6,9H,3-5,16-17H2,1-2H3 |
| InChIKey | OJCUNJBMNXRVJP-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 75.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.77 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|