C14H21N3O — CID 89155190
1-(4-aminophenyl)-N,N-dimethylpiperidine-2-carboxamide (PubChem CID 89155190) has the molecular formula C14H21N3O and a molecular weight of 247.34 g/mol. Its IUPAC name is 1-(4-aminophenyl)-N,N-dimethylpiperidine-2-carboxamide.
| Compound Name | 1-(4-aminophenyl)-N,N-dimethylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 89155190 |
| Molecular Formula | C14H21N3O |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | 1-(4-aminophenyl)-N,N-dimethylpiperidine-2-carboxamide |
| SMILES | CN(C)C(=O)C1CCCCN1c1ccc(N)cc1 |
| InChI | InChI=1S/C14H21N3O/c1-16(2)14(18)13-5-3-4-10-17(13)12-8-6-11(15)7-9-12/h6-9,13H,3-5,10,15H2,1-2H3 |
| InChIKey | ACEUILQWYHHEFO-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|