C13H19ClN4O — CID 129391550
(2S)-1-(4,5-diamino-2-chlorophenyl)-N,N-dimethylpyrrolidine-2-carboxamide (PubChem CID 129391550) has the molecular formula C13H19ClN4O and a molecular weight of 282.78 g/mol. Its IUPAC name is (2S)-1-(4,5-diamino-2-chlorophenyl)-N,N-dimethylpyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-(4,5-diamino-2-chlorophenyl)-N,N-dimethylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 129391550 |
| Molecular Formula | C13H19ClN4O |
| Molecular Weight | 282.78 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | (2S)-1-(4,5-diamino-2-chlorophenyl)-N,N-dimethylpyrrolidine-2-carboxamide |
| SMILES | CN(C)C(=O)[C@@H]1CCCN1c1cc(N)c(N)cc1Cl |
| InChI | InChI=1S/C13H19ClN4O/c1-17(2)13(19)11-4-3-5-18(11)12-7-10(16)9(15)6-8(12)14/h6-7,11H,3-5,15-16H2,1-2H3/t11-/m0/s1 |
| InChIKey | YNIUCOSYYUYTJJ-NSHDSACASA-N |
| XLogP | 1.56 |
| TPSA | 75.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.78 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|