C14H19FN4O — CID 79091898
7-[2-fluoro-4-(methylaminomethyl)phenyl]-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one (PubChem CID 79091898) has the molecular formula C14H19FN4O and a molecular weight of 278.33 g/mol. Its IUPAC name is 7-[2-fluoro-4-(methylaminomethyl)phenyl]-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one.
| Compound Name | 7-[2-fluoro-4-(methylaminomethyl)phenyl]-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one |
|---|---|
| PubChem CID | 79091898 |
| Molecular Formula | C14H19FN4O |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 7-[2-fluoro-4-(methylaminomethyl)phenyl]-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one |
| SMILES | CNCc1ccc(N2CCN3C(=O)NCC3C2)c(F)c1 |
| InChI | InChI=1S/C14H19FN4O/c1-16-7-10-2-3-13(12(15)6-10)18-4-5-19-11(9-18)8-17-14(19)20/h2-3,6,11,16H,4-5,7-9H2,1H3,(H,17,20) |
| InChIKey | QREBIYNPVJWMPU-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|