C15H21FN4O — CID 79096421
7-[4-(ethylaminomethyl)-2-fluorophenyl]-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one (PubChem CID 79096421) has the molecular formula C15H21FN4O and a molecular weight of 292.36 g/mol. Its IUPAC name is 7-[4-(ethylaminomethyl)-2-fluorophenyl]-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one.
| Compound Name | 7-[4-(ethylaminomethyl)-2-fluorophenyl]-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one |
|---|---|
| PubChem CID | 79096421 |
| Molecular Formula | C15H21FN4O |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | 7-[4-(ethylaminomethyl)-2-fluorophenyl]-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one |
| SMILES | CCNCc1ccc(N2CCN3C(=O)NCC3C2)c(F)c1 |
| InChI | InChI=1S/C15H21FN4O/c1-2-17-8-11-3-4-14(13(16)7-11)19-5-6-20-12(10-19)9-18-15(20)21/h3-4,7,12,17H,2,5-6,8-10H2,1H3,(H,18,21) |
| InChIKey | XANJOZFGHTWJLI-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|