C14H24N4S — CID 81206031
1-[2-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)-1,3-thiazol-4-yl]ethanamine (PubChem CID 81206031) has the molecular formula C14H24N4S and a molecular weight of 280.44 g/mol. Its IUPAC name is 1-[2-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)-1,3-thiazol-4-yl]ethanamine.
| Compound Name | 1-[2-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)-1,3-thiazol-4-yl]ethanamine |
|---|---|
| PubChem CID | 81206031 |
| Molecular Formula | C14H24N4S |
| Molecular Weight | 280.44 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 1-[2-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)-1,3-thiazol-4-yl]ethanamine |
| SMILES | CC(N)c1csc(N2CCC3C(CCCN3C)C2)n1 |
| InChI | InChI=1S/C14H24N4S/c1-10(15)12-9-19-14(16-12)18-7-5-13-11(8-18)4-3-6-17(13)2/h9-11,13H,3-8,15H2,1-2H3 |
| InChIKey | DTGQRSDGDNACFV-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.44 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |