C16H23N3OS — CID 81193537
2-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)-6,7-dihydro-5H-1,3-benzothiazol-4-one (PubChem CID 81193537) has the molecular formula C16H23N3OS and a molecular weight of 305.45 g/mol. Its IUPAC name is 2-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)-6,7-dihydro-5H-1,3-benzothiazol-4-one.
| Compound Name | 2-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)-6,7-dihydro-5H-1,3-benzothiazol-4-one |
|---|---|
| PubChem CID | 81193537 |
| Molecular Formula | C16H23N3OS |
| Molecular Weight | 305.45 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | 2-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)-6,7-dihydro-5H-1,3-benzothiazol-4-one |
| SMILES | CN1CCCC2CN(c3nc4c(s3)CCCC4=O)CCC21 |
| InChI | InChI=1S/C16H23N3OS/c1-18-8-3-4-11-10-19(9-7-12(11)18)16-17-15-13(20)5-2-6-14(15)21-16/h11-12H,2-10H2,1H3 |
| InChIKey | QGYYYEWLLYTPNC-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.45 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |