C19H12Cl2F6N6O2 — CID 90735212
4-[(2,6-dichlorophenyl)methyldiazenyl]-6-(2,2,2-trifluoroethoxy)-N-[4-(trifluoromethoxy)phenyl]-1,3,5-triazin-2-amine (PubChem CID 90735212) has the molecular formula C19H12Cl2F6N6O2 and a molecular weight of 541.24 g/mol. Its IUPAC name is 4-[(2,6-dichlorophenyl)methyldiazenyl]-6-(2,2,2-trifluoroethoxy)-N-[4-(trifluoromethoxy)phenyl]-1,3,5-triazin-2-amine.
| Compound Name | 4-[(2,6-dichlorophenyl)methyldiazenyl]-6-(2,2,2-trifluoroethoxy)-N-[4-(trifluoromethoxy)phenyl]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 90735212 |
| Molecular Formula | C19H12Cl2F6N6O2 |
| Molecular Weight | 541.24 g/mol |
| Exact Mass | 540.03 |
| IUPAC Name | 4-[(2,6-dichlorophenyl)methyldiazenyl]-6-(2,2,2-trifluoroethoxy)-N-[4-(trifluoromethoxy)phenyl]-1,3,5-triazin-2-amine |
| SMILES | FC(F)(F)COc1nc(/N=N/Cc2c(Cl)cccc2Cl)nc(Nc2ccc(OC(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C19H12Cl2F6N6O2/c20-13-2-1-3-14(21)12(13)8-28-33-16-30-15(31-17(32-16)34-9-18(22,23)24)29-10-4-6-11(7-5-10)35-19(25,26)27/h1-7H,8-9H2,(H,29,30,31,32)/b33-28+ |
| InChIKey | JTVIEUXQBGZRKF-PJJLUWSFSA-N |
| XLogP | 7.05 |
| TPSA | 93.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.24 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|