C15H8Cl2F3N3O — CID 177312599
3,8-dichloro-N-[4-(trifluoromethoxy)phenyl]quinoxalin-2-amine (PubChem CID 177312599) has the molecular formula C15H8Cl2F3N3O and a molecular weight of 374.15 g/mol. Its IUPAC name is 3,8-dichloro-N-[4-(trifluoromethoxy)phenyl]quinoxalin-2-amine.
| Compound Name | 3,8-dichloro-N-[4-(trifluoromethoxy)phenyl]quinoxalin-2-amine |
|---|---|
| PubChem CID | 177312599 |
| Molecular Formula | C15H8Cl2F3N3O |
| Molecular Weight | 374.15 g/mol |
| Exact Mass | 373.00 |
| IUPAC Name | 3,8-dichloro-N-[4-(trifluoromethoxy)phenyl]quinoxalin-2-amine |
| SMILES | FC(F)(F)Oc1ccc(Nc2nc3c(Cl)cccc3nc2Cl)cc1 |
| InChI | InChI=1S/C15H8Cl2F3N3O/c16-10-2-1-3-11-12(10)23-14(13(17)22-11)21-8-4-6-9(7-5-8)24-15(18,19)20/h1-7H,(H,21,23) |
| InChIKey | ADZRWGFLZMMLMA-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.15 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |