C21H20FNO3 — CID 170330860
ethyl 3-[6-fluoro-2-(3-methoxyphenyl)quinolin-4-yl]propanoate (PubChem CID 170330860) has the molecular formula C21H20FNO3 and a molecular weight of 353.39 g/mol. Its IUPAC name is ethyl 3-[6-fluoro-2-(3-methoxyphenyl)quinolin-4-yl]propanoate.
| Compound Name | ethyl 3-[6-fluoro-2-(3-methoxyphenyl)quinolin-4-yl]propanoate |
|---|---|
| PubChem CID | 170330860 |
| Molecular Formula | C21H20FNO3 |
| Molecular Weight | 353.39 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | ethyl 3-[6-fluoro-2-(3-methoxyphenyl)quinolin-4-yl]propanoate |
| SMILES | CCOC(=O)CCc1cc(-c2cccc(OC)c2)nc2ccc(F)cc12 |
| InChI | InChI=1S/C21H20FNO3/c1-3-26-21(24)10-7-14-12-20(15-5-4-6-17(11-15)25-2)23-19-9-8-16(22)13-18(14)19/h4-6,8-9,11-13H,3,7,10H2,1-2H3 |
| InChIKey | OOMZUEJRPHKYOU-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.39 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |