C21H21F2N3O2 — CID 56574373
ethyl 2-benzyl-3-[[2-(difluoromethyl)quinazolin-4-yl]amino]propanoate (PubChem CID 56574373) has the molecular formula C21H21F2N3O2 and a molecular weight of 385.41 g/mol. Its IUPAC name is ethyl 2-benzyl-3-[[2-(difluoromethyl)quinazolin-4-yl]amino]propanoate.
| Compound Name | ethyl 2-benzyl-3-[[2-(difluoromethyl)quinazolin-4-yl]amino]propanoate |
|---|---|
| PubChem CID | 56574373 |
| Molecular Formula | C21H21F2N3O2 |
| Molecular Weight | 385.41 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | ethyl 2-benzyl-3-[[2-(difluoromethyl)quinazolin-4-yl]amino]propanoate |
| SMILES | CCOC(=O)C(CNc1nc(C(F)F)nc2ccccc12)Cc1ccccc1 |
| InChI | InChI=1S/C21H21F2N3O2/c1-2-28-21(27)15(12-14-8-4-3-5-9-14)13-24-19-16-10-6-7-11-17(16)25-20(26-19)18(22)23/h3-11,15,18H,2,12-13H2,1H3,(H,24,25,26) |
| InChIKey | MVFQCVORUFQHJW-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.41 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |