C28H37N3O — CID 134186594
N-[3-(5-ethoxyhex-5-enyl)-4-ethylphenyl]-2-methyl-N-propylquinazolin-4-amine (PubChem CID 134186594) has the molecular formula C28H37N3O and a molecular weight of 431.62 g/mol. Its IUPAC name is N-[3-(5-ethoxyhex-5-enyl)-4-ethylphenyl]-2-methyl-N-propylquinazolin-4-amine.
| Compound Name | N-[3-(5-ethoxyhex-5-enyl)-4-ethylphenyl]-2-methyl-N-propylquinazolin-4-amine |
|---|---|
| PubChem CID | 134186594 |
| Molecular Formula | C28H37N3O |
| Molecular Weight | 431.62 g/mol |
| Exact Mass | 431.29 |
| IUPAC Name | N-[3-(5-ethoxyhex-5-enyl)-4-ethylphenyl]-2-methyl-N-propylquinazolin-4-amine |
| SMILES | C=C(CCCCc1cc(N(CCC)c2nc(C)nc3ccccc23)ccc1CC)OCC |
| InChI | InChI=1S/C28H37N3O/c1-6-19-31(28-26-15-11-12-16-27(26)29-22(5)30-28)25-18-17-23(7-2)24(20-25)14-10-9-13-21(4)32-8-3/h11-12,15-18,20H,4,6-10,13-14,19H2,1-3,5H3 |
| InChIKey | XCVBZDHMQGGOKS-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.62 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|