C24H30N4O3 — CID 25226359
N-hydroxy-8-[4-(4-methoxy-N-methylanilino)quinazolin-2-yl]octanamide (PubChem CID 25226359) has the molecular formula C24H30N4O3 and a molecular weight of 422.53 g/mol. Its IUPAC name is N-hydroxy-8-[4-(4-methoxy-N-methylanilino)quinazolin-2-yl]octanamide.
| Compound Name | N-hydroxy-8-[4-(4-methoxy-N-methylanilino)quinazolin-2-yl]octanamide |
|---|---|
| PubChem CID | 25226359 |
| Molecular Formula | C24H30N4O3 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | N-hydroxy-8-[4-(4-methoxy-N-methylanilino)quinazolin-2-yl]octanamide |
| SMILES | COc1ccc(N(C)c2nc(CCCCCCCC(=O)NO)nc3ccccc23)cc1 |
| InChI | InChI=1S/C24H30N4O3/c1-28(18-14-16-19(31-2)17-15-18)24-20-10-8-9-11-21(20)25-22(26-24)12-6-4-3-5-7-13-23(29)27-30/h8-11,14-17,30H,3-7,12-13H2,1-2H3,(H,27,29) |
| InChIKey | QRDVBUSHYSVDNV-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|