C17H15N3O2 — CID 110390940
N-(3,4-dimethylphenyl)-5-phenyl-1,3,4-oxadiazole-2-carboxamide (PubChem CID 110390940) has the molecular formula C17H15N3O2 and a molecular weight of 293.33 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-5-phenyl-1,3,4-oxadiazole-2-carboxamide.
| Compound Name | N-(3,4-dimethylphenyl)-5-phenyl-1,3,4-oxadiazole-2-carboxamide |
|---|---|
| PubChem CID | 110390940 |
| Molecular Formula | C17H15N3O2 |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | N-(3,4-dimethylphenyl)-5-phenyl-1,3,4-oxadiazole-2-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2nnc(-c3ccccc3)o2)cc1C |
| InChI | InChI=1S/C17H15N3O2/c1-11-8-9-14(10-12(11)2)18-15(21)17-20-19-16(22-17)13-6-4-3-5-7-13/h3-10H,1-2H3,(H,18,21) |
| InChIKey | TWNZAUVLVRRQQD-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |