C16H12BrN3O2 — CID 110391151
N-(4-bromophenyl)-5-(4-methylphenyl)-1,3,4-oxadiazole-2-carboxamide (PubChem CID 110391151) has the molecular formula C16H12BrN3O2 and a molecular weight of 358.20 g/mol. Its IUPAC name is N-(4-bromophenyl)-5-(4-methylphenyl)-1,3,4-oxadiazole-2-carboxamide.
| Compound Name | N-(4-bromophenyl)-5-(4-methylphenyl)-1,3,4-oxadiazole-2-carboxamide |
|---|---|
| PubChem CID | 110391151 |
| Molecular Formula | C16H12BrN3O2 |
| Molecular Weight | 358.20 g/mol |
| Exact Mass | 357.01 |
| IUPAC Name | N-(4-bromophenyl)-5-(4-methylphenyl)-1,3,4-oxadiazole-2-carboxamide |
| SMILES | Cc1ccc(-c2nnc(C(=O)Nc3ccc(Br)cc3)o2)cc1 |
| InChI | InChI=1S/C16H12BrN3O2/c1-10-2-4-11(5-3-10)15-19-20-16(22-15)14(21)18-13-8-6-12(17)7-9-13/h2-9H,1H3,(H,18,21) |
| InChIKey | UOQJEQPXIBCXKZ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.20 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |